A1LXL
Beta-Sitosterol
| Created: | 2024-02-02 |
| Last modified: | 2024-11-18 |
Find Related PDB Entry |
|---|
Find related ligands: |
|---|
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 80 |
| Chiral Atom Count | 9 |
| Bond Count | 83 |
| Aromatic Bond Count | 0 |
Chemical Component Summary | |
|---|---|
| Name | Beta-Sitosterol |
| Synonyms | (3S,8S,9S,10R,13R,14S,17R)-17-[(2R,5R)-5-ethyl-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| Systematic Name (OpenEye OEToolkits) | (3~{S},8~{S},9~{S},10~{R},13~{R},14~{S},17~{R})-17-[(2~{R},5~{R})-5-ethyl-6-methyl-heptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1~{H}-cyclopenta[a]phenanthren-3-ol |
| Formula | C29 H50 O |
| Molecular Weight | 414.707 |
| Type | NON-POLYMER |
Chemical Descriptors | |||
|---|---|---|---|
| Type | Program | Version | Descriptor |
| SMILES | CACTVS | 3.385 | CC[CH](CC[CH](C)[CH]1CC[CH]2[CH]3CC=C4C[CH](O)CC[C]4(C)[CH]3CC[C]12C)C(C)C |
| SMILES | OpenEye OEToolkits | 2.0.7 | CCC(CCC(C)C1CCC2C1(CCC3C2CC=C4C3(CCC(C4)O)C)C)C(C)C |
| Canonical SMILES | CACTVS | 3.385 | CC[C@H](CC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C)C(C)C |
| Canonical SMILES | OpenEye OEToolkits | 2.0.7 | CC[C@H](CC[C@@H](C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC=C4[C@@]3(CC[C@@H](C4)O)C)C)C(C)C |
| InChI | InChI | 1.06 | InChI=1S/C29H50O/c1-7-21(19(2)3)9-8-20(4)25-12-13-26-24-11-10-22-18-23(30)14-16-28(22,5)27(24)15-17-29(25,26)6/h10,19-21,23-27,30H,7-9,11-18H2,1-6H3/t20-,21-,23+,24+,25-,26+,27+,28+,29-/m1/s1 |
| InChIKey | InChI | 1.06 | KZJWDPNRJALLNS-VJSFXXLFSA-N |
Drug Info: DrugBank
DrugBank data are sourced from datasets licensed under a Creative Common's Attribution-NonCommercial 4.0 International License
| DrugBank ID | DB14038 |
|---|---|
| Name | beta-Sitosterol |
| Groups | experimental |
| Description | Active fraction of Solanum trilobatum; reduces side-effects of radiation-induced toxicity. |
| Synonyms |
|
| Brand Names |
|
| Categories |
|
| CAS number | 83-46-5 |
Related Resource References
| Resource Name | Reference |
|---|---|
| Pharos | CHEMBL221542 |
| PubChem | 222284 |
| ChEMBL | CHEMBL221542 |
| ChEBI | CHEBI:176889, CHEBI:27693 |
| COD | 7240606, 7240604, 7240608 |














