2DL
2-METHYL-4-DIETHYLAMIDE-PHENOL
| Created: | 2010-05-04 |
| Last modified: | 2011-06-04 |
Find Related PDB Entry |
|---|
Find related ligands: |
|---|
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 33 |
| Chiral Atom Count | 0 |
| Bond Count | 33 |
| Aromatic Bond Count | 6 |
Chemical Component Summary | |
|---|---|
| Name | 2-METHYL-4-DIETHYLAMIDE-PHENOL |
| Systematic Name (OpenEye OEToolkits) | N,N-diethyl-4-hydroxy-3-methoxy-benzamide |
| Formula | C12 H17 N O3 |
| Molecular Weight | 223.268 |
| Type | NON-POLYMER |
Chemical Descriptors | |||
|---|---|---|---|
| Type | Program | Version | Descriptor |
| SMILES | ACDLabs | 10.04 | O=C(c1cc(OC)c(O)cc1)N(CC)CC |
| SMILES | CACTVS | 3.352 | CCN(CC)C(=O)c1ccc(O)c(OC)c1 |
| SMILES | OpenEye OEToolkits | 1.6.1 | CCN(CC)C(=O)c1ccc(c(c1)OC)O |
| Canonical SMILES | CACTVS | 3.352 | CCN(CC)C(=O)c1ccc(O)c(OC)c1 |
| Canonical SMILES | OpenEye OEToolkits | 1.6.1 | CCN(CC)C(=O)c1ccc(c(c1)OC)O |
| InChI | InChI | 1.03 | InChI=1S/C12H17NO3/c1-4-13(5-2)12(15)9-6-7-10(14)11(8-9)16-3/h6-8,14H,4-5H2,1-3H3 |
| InChIKey | InChI | 1.03 | BQJODPIMMWWMFC-UHFFFAOYSA-N |
Drug Info: DrugBank
DrugBank data are sourced from datasets licensed under a Creative Common's Attribution-NonCommercial 4.0 International License
| DrugBank ID | DB08989 |
|---|---|
| Name | Etamivan |
| Groups | withdrawn |
| Description | Etamivan (INN) or ethamivan (USAN) is marketed under the name Analepticon. Etamvin is a respiratory stimulant drug similar to nikethamide. It is no longer used in the United States. |
| Synonyms |
|
| Categories |
|
| ATC-Code | R07AB04 |
| CAS number | 304-84-7 |
Related Resource References
| Resource Name | Reference |
|---|---|
| PubChem | 9363 |
| ChEMBL | CHEMBL1229908 |
| ChEBI | CHEBI:92675 |














